C21H22FN7O3 — CID 162029390
butyl 2-[6-[[6-fluoro-1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]oxymethyl]-2-pyridinyl]acetate (PubChem CID 162029390) has the molecular formula C21H22FN7O3 and a molecular weight of 439.45 g/mol. Its IUPAC name is butyl 2-[6-[[6-fluoro-1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]oxymethyl]-2-pyridinyl]acetate.
| Compound Name | butyl 2-[6-[[6-fluoro-1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]oxymethyl]-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 162029390 |
| Molecular Formula | C21H22FN7O3 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | butyl 2-[6-[[6-fluoro-1-(1-methyltetrazol-5-yl)benzimidazol-2-yl]oxymethyl]-2-pyridinyl]acetate |
| SMILES | CCCCOC(=O)Cc1cccc(COc2nc3ccc(F)cc3n2-c2nnnn2C)n1 |
| InChI | InChI=1S/C21H22FN7O3/c1-3-4-10-31-19(30)12-15-6-5-7-16(23-15)13-32-21-24-17-9-8-14(22)11-18(17)29(21)20-25-26-27-28(20)2/h5-9,11H,3-4,10,12-13H2,1-2H3 |
| InChIKey | NCCHXMJIRSEHAW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 109.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|