C35H60O9 — CID 162030037
2-(3-acetyloxy-4,5-dimethyloxan-2-yl)oxyethyl 2,2-dimethylbutanoate;butan-2-ylbenzene;2-hydroxyethyl 2,2-dimethylbutanoate (PubChem CID 162030037) has the molecular formula C35H60O9 and a molecular weight of 624.86 g/mol. Its IUPAC name is 2-(3-acetyloxy-4,5-dimethyloxan-2-yl)oxyethyl 2,2-dimethylbutanoate;butan-2-ylbenzene;2-hydroxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-(3-acetyloxy-4,5-dimethyloxan-2-yl)oxyethyl 2,2-dimethylbutanoate;butan-2-ylbenzene;2-hydroxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 162030037 |
| Molecular Formula | C35H60O9 |
| Molecular Weight | 624.86 g/mol |
| Exact Mass | 624.42 |
| IUPAC Name | 2-(3-acetyloxy-4,5-dimethyloxan-2-yl)oxyethyl 2,2-dimethylbutanoate;butan-2-ylbenzene;2-hydroxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCO.CCC(C)(C)C(=O)OCCOC1OCC(C)C(C)C1OC(C)=O.CCC(C)c1ccccc1 |
| InChI | InChI=1S/C17H30O6.C10H14.C8H16O3/c1-7-17(5,6)16(19)21-9-8-20-15-14(23-13(4)18)12(3)11(2)10-22-15;1-3-9(2)10-7-5-4-6-8-10;1-4-8(2,3)7(10)11-6-5-9/h11-12,14-15H,7-10H2,1-6H3;4-9H,3H2,1-2H3;9H,4-6H2,1-3H3 |
| InChIKey | YVWXKXKMFWONHI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.86 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|