C21H24O7 — CID 162030077
(4S,6Z,10S,12E)-10,18-dihydroxy-15-(3-hydroxyprop-1-ynyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate (PubChem CID 162030077) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is (4S,6Z,10S,12E)-10,18-dihydroxy-15-(3-hydroxyprop-1-ynyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate.
| Compound Name | (4S,6Z,10S,12E)-10,18-dihydroxy-15-(3-hydroxyprop-1-ynyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate |
|---|---|
| PubChem CID | 162030077 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | (4S,6Z,10S,12E)-10,18-dihydroxy-15-(3-hydroxyprop-1-ynyl)-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(18),6,12,14,16-pentaene-2,8-dione;hydrate |
| SMILES | C[C@H]1C/C=C\C(=O)C[C@@H](O)C/C=C/c2c(C#CCO)ccc(O)c2C(=O)O1.O |
| InChI | InChI=1S/C21H22O6.H2O/c1-14-5-2-7-16(23)13-17(24)8-3-9-18-15(6-4-12-22)10-11-19(25)20(18)21(26)27-14;/h2-3,7,9-11,14,17,22,24-25H,5,8,12-13H2,1H3;1H2/b7-2-,9-3+;/t14-,17-;/m0./s1 |
| InChIKey | FCDAAXAZUORPLR-YIQNXUPYSA-N |
| XLogP | 1.14 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|