About 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone
3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone (PubChem CID 162030101) has the molecular formula C14H16F2N4O3
and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone.
Molecular Properties
| Compound Name | 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone |
| PubChem CID | 162030101 |
| Molecular Formula | C14H16F2N4O3 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone |
| SMILES | COc1ccc(C(C)(F)F)nn1.COc1ccc(C(C)=O)nn1 |
| InChI | InChI=1S/C7H8F2N2O.C7H8N2O2/c1-7(8,9)5-3-4-6(12-2)11-10-5;1-5(10)6-3-4-7(11-2)9-8-6/h3-4H,1-2H3;3-4H,1-2H3 |
| InChIKey | YVXDQNFLXUSFKJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 87.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone?
The IUPAC name of 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone (CID 162030101) is 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone.
What is the SMILES notation for 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone?
The canonical SMILES for 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone is COc1ccc(C(C)(F)F)nn1.COc1ccc(C(C)=O)nn1.
What is the InChIKey of 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone?
The InChIKey is YVXDQNFLXUSFKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O.C7H8N2O2/c1-7(8,9)5-3-4-6(12-2)11-10-5;1-5(10)6-3-4-7(11-2)9-8-6/h3-4H,1-2H3;3-4H,1-2H3.
What are the key properties of 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone?
3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone has a molecular weight of 326.30 g/mol, XLogP of 2.28, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,1-difluoroethyl)-6-methoxypyridazine;1-(6-methoxypyridazin-3-yl)ethanone is sourced from PubChem (CID 162030101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).