About 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine
8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine (PubChem CID 162030854) has the molecular formula C10H13N3
and a molecular weight of 175.24 g/mol. Its IUPAC name is 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine.
Molecular Properties
| Compound Name | 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine |
| PubChem CID | 162030854 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine |
| SMILES | CC1=CC=C2C(N)=NC=NCC2C1 |
| InChI | InChI=1S/C10H13N3/c1-7-2-3-9-8(4-7)5-12-6-13-10(9)11/h2-3,6,8H,4-5H2,1H3,(H2,11,12,13) |
| InChIKey | YVZUEYZFKHPYMA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine?
The IUPAC name of 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine (CID 162030854) is 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine.
What is the SMILES notation for 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine?
The canonical SMILES for 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine is CC1=CC=C2C(N)=NC=NCC2C1.
What is the InChIKey of 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine?
The InChIKey is YVZUEYZFKHPYMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3/c1-7-2-3-9-8(4-7)5-12-6-13-10(9)11/h2-3,6,8H,4-5H2,1H3,(H2,11,12,13).
What are the key properties of 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine?
8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine has a molecular weight of 175.24 g/mol, XLogP of 1.28, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-9,9a-dihydro-1H-2,4-benzodiazepin-5-amine is sourced from PubChem (CID 162030854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).