C40H36F6O7S3 — CID 162031095
3-(4-ethenylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate;2-(4-ethenylphenyl)propan-2-ol;triphenylsulfanium (PubChem CID 162031095) has the molecular formula C40H36F6O7S3 and a molecular weight of 838.91 g/mol. Its IUPAC name is 3-(4-ethenylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate;2-(4-ethenylphenyl)propan-2-ol;triphenylsulfanium.
| Compound Name | 3-(4-ethenylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate;2-(4-ethenylphenyl)propan-2-ol;triphenylsulfanium |
|---|---|
| PubChem CID | 162031095 |
| Molecular Formula | C40H36F6O7S3 |
| Molecular Weight | 838.91 g/mol |
| Exact Mass | 838.15 |
| IUPAC Name | 3-(4-ethenylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonate;2-(4-ethenylphenyl)propan-2-ol;triphenylsulfanium |
| SMILES | C=Cc1ccc(C(C)(C)O)cc1.C=Cc1ccc(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[O-])cc1.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C11H8F6O6S2.C11H14O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-7-3-5-8(6-4-7)23-25(21,22)11(16,17)9(12,13)10(14,15)24(18,19)20;1-4-9-5-7-10(8-6-9)11(2,3)12/h1-15H;2-6H,1H2,(H,18,19,20);4-8,12H,1H2,2-3H3/q+1;;/p-1 |
| InChIKey | YWANGEUIWMBGEH-UHFFFAOYSA-M |
| XLogP | 9.74 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.91 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|