C21H24N4O — CID 162031276
2-[4-[4-(4-oxo-5,6,7,8-tetrahydro-3H-quinolin-2-yl)piperazin-1-yl]phenyl]acetonitrile (PubChem CID 162031276) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is 2-[4-[4-(4-oxo-5,6,7,8-tetrahydro-3H-quinolin-2-yl)piperazin-1-yl]phenyl]acetonitrile.
| Compound Name | 2-[4-[4-(4-oxo-5,6,7,8-tetrahydro-3H-quinolin-2-yl)piperazin-1-yl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 162031276 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 2-[4-[4-(4-oxo-5,6,7,8-tetrahydro-3H-quinolin-2-yl)piperazin-1-yl]phenyl]acetonitrile |
| SMILES | N#CCc1ccc(N2CCN(C3=NC4=C(CCCC4)C(=O)C3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O/c22-10-9-16-5-7-17(8-6-16)24-11-13-25(14-12-24)21-15-20(26)18-3-1-2-4-19(18)23-21/h5-8H,1-4,9,11-15H2 |
| InChIKey | YWAZQFODSQCEKV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|