About 1-chloro-9H-fluorene-2-sulfonic acid;thiophene
1-chloro-9H-fluorene-2-sulfonic acid;thiophene (PubChem CID 162031417) has the molecular formula C17H13ClO3S2
and a molecular weight of 364.88 g/mol. Its IUPAC name is 1-chloro-9H-fluorene-2-sulfonic acid;thiophene.
Molecular Properties
| Compound Name | 1-chloro-9H-fluorene-2-sulfonic acid;thiophene |
| PubChem CID | 162031417 |
| Molecular Formula | C17H13ClO3S2 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 1-chloro-9H-fluorene-2-sulfonic acid;thiophene |
| SMILES | O=S(=O)(O)c1ccc2c(c1Cl)Cc1ccccc1-2.c1ccsc1 |
| InChI | InChI=1S/C13H9ClO3S.C4H4S/c14-13-11-7-8-3-1-2-4-9(8)10(11)5-6-12(13)18(15,16)17;1-2-4-5-3-1/h1-6H,7H2,(H,15,16,17);1-4H |
| InChIKey | YWBNDWFUJDGAPN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-9H-fluorene-2-sulfonic acid;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-9H-fluorene-2-sulfonic acid;thiophene?
The IUPAC name of 1-chloro-9H-fluorene-2-sulfonic acid;thiophene (CID 162031417) is 1-chloro-9H-fluorene-2-sulfonic acid;thiophene.
What is the SMILES notation for 1-chloro-9H-fluorene-2-sulfonic acid;thiophene?
The canonical SMILES for 1-chloro-9H-fluorene-2-sulfonic acid;thiophene is O=S(=O)(O)c1ccc2c(c1Cl)Cc1ccccc1-2.c1ccsc1.
What is the InChIKey of 1-chloro-9H-fluorene-2-sulfonic acid;thiophene?
The InChIKey is YWBNDWFUJDGAPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClO3S.C4H4S/c14-13-11-7-8-3-1-2-4-9(8)10(11)5-6-12(13)18(15,16)17;1-2-4-5-3-1/h1-6H,7H2,(H,15,16,17);1-4H.
What are the key properties of 1-chloro-9H-fluorene-2-sulfonic acid;thiophene?
1-chloro-9H-fluorene-2-sulfonic acid;thiophene has a molecular weight of 364.88 g/mol, XLogP of 4.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-9H-fluorene-2-sulfonic acid;thiophene is sourced from PubChem (CID 162031417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).