About oxathiino[6,5-b]pyridine 2,2-dioxide
oxathiino[6,5-b]pyridine 2,2-dioxide (PubChem CID 162032669) has the molecular formula C7H5NO3S
and a molecular weight of 183.19 g/mol. Its IUPAC name is oxathiino[6,5-b]pyridine 2,2-dioxide.
Molecular Properties
| Compound Name | oxathiino[6,5-b]pyridine 2,2-dioxide |
| PubChem CID | 162032669 |
| Molecular Formula | C7H5NO3S |
| Molecular Weight | 183.19 g/mol |
| Exact Mass | 183.00 |
| IUPAC Name | oxathiino[6,5-b]pyridine 2,2-dioxide |
| SMILES | O=S1(=O)C=Cc2cccnc2O1 |
| InChI | InChI=1S/C7H5NO3S/c9-12(10)5-3-6-2-1-4-8-7(6)11-12/h1-5H |
| InChIKey | YWFTXZLJLGZWAD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze oxathiino[6,5-b]pyridine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxathiino[6,5-b]pyridine 2,2-dioxide?
The IUPAC name of oxathiino[6,5-b]pyridine 2,2-dioxide (CID 162032669) is oxathiino[6,5-b]pyridine 2,2-dioxide.
What is the SMILES notation for oxathiino[6,5-b]pyridine 2,2-dioxide?
The canonical SMILES for oxathiino[6,5-b]pyridine 2,2-dioxide is O=S1(=O)C=Cc2cccnc2O1.
What is the InChIKey of oxathiino[6,5-b]pyridine 2,2-dioxide?
The InChIKey is YWFTXZLJLGZWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S/c9-12(10)5-3-6-2-1-4-8-7(6)11-12/h1-5H.
What are the key properties of oxathiino[6,5-b]pyridine 2,2-dioxide?
oxathiino[6,5-b]pyridine 2,2-dioxide has a molecular weight of 183.19 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxathiino[6,5-b]pyridine 2,2-dioxide is sourced from PubChem (CID 162032669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).