C31H61F8N3O — CID 162033576
N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine;N,N'-ditert-butyl-3,3,4,4,5,5-hexafluoroheptane-1,7-diamine (PubChem CID 162033576) has the molecular formula C31H61F8N3O and a molecular weight of 643.83 g/mol. Its IUPAC name is N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine;N,N'-ditert-butyl-3,3,4,4,5,5-hexafluoroheptane-1,7-diamine.
| Compound Name | N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine;N,N'-ditert-butyl-3,3,4,4,5,5-hexafluoroheptane-1,7-diamine |
|---|---|
| PubChem CID | 162033576 |
| Molecular Formula | C31H61F8N3O |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.47 |
| IUPAC Name | N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine;N,N'-ditert-butyl-3,3,4,4,5,5-hexafluoroheptane-1,7-diamine |
| SMILES | CC(C)(C)CCCOCCC(F)(F)CCNC(C)(C)C.CC(C)(C)NCCC(F)(F)C(F)(F)C(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C16H33F2NO.C15H28F6N2/c1-14(2,3)8-7-12-20-13-10-16(17,18)9-11-19-15(4,5)6;1-11(2,3)22-9-7-13(16,17)15(20,21)14(18,19)8-10-23-12(4,5)6/h19H,7-13H2,1-6H3;22-23H,7-10H2,1-6H3 |
| InChIKey | YWIVKUIDIXSKJS-UHFFFAOYSA-N |
| XLogP | 9.08 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|