About 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol
3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol (PubChem CID 162037567) has the molecular formula C19H34Br2O7
and a molecular weight of 534.28 g/mol. Its IUPAC name is 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol.
Molecular Properties
| Compound Name | 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol |
| PubChem CID | 162037567 |
| Molecular Formula | C19H34Br2O7 |
| Molecular Weight | 534.28 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CC(C)(C)OC(=O)CC1(CBr)COC1.O=C(O)C1(CBr)COC1 |
| InChI | InChI=1S/C10H17BrO3.C5H7BrO3.C4H10O/c1-9(2,3)14-8(12)4-10(5-11)6-13-7-10;6-1-5(4(7)8)2-9-3-5;1-4(2,3)5/h4-7H2,1-3H3;1-3H2,(H,7,8);5H,1-3H3 |
| InChIKey | YWVRZIUGYBASPP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 534.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol?
The IUPAC name of 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol (CID 162037567) is 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol.
What is the SMILES notation for 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol?
The canonical SMILES for 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol is CC(C)(C)O.CC(C)(C)OC(=O)CC1(CBr)COC1.O=C(O)C1(CBr)COC1.
What is the InChIKey of 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol?
The InChIKey is YWVRZIUGYBASPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17BrO3.C5H7BrO3.C4H10O/c1-9(2,3)14-8(12)4-10(5-11)6-13-7-10;6-1-5(4(7)8)2-9-3-5;1-4(2,3)5/h4-7H2,1-3H3;1-3H2,(H,7,8);5H,1-3H3.
What are the key properties of 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol?
3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol has a molecular weight of 534.28 g/mol, XLogP of 3.39, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(bromomethyl)oxetane-3-carboxylic acid;tert-butyl 2-[3-(bromomethyl)oxetan-3-yl]acetate;2-methylpropan-2-ol is sourced from PubChem (CID 162037567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).