C18H18FNO — CID 162037894
2-[3-(4-fluorophenoxy)phenyl]-2,3,4,5-tetrahydro-1H-azepine (PubChem CID 162037894) has the molecular formula C18H18FNO and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[3-(4-fluorophenoxy)phenyl]-2,3,4,5-tetrahydro-1H-azepine.
| Compound Name | 2-[3-(4-fluorophenoxy)phenyl]-2,3,4,5-tetrahydro-1H-azepine |
|---|---|
| PubChem CID | 162037894 |
| Molecular Formula | C18H18FNO |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 2-[3-(4-fluorophenoxy)phenyl]-2,3,4,5-tetrahydro-1H-azepine |
| SMILES | Fc1ccc(Oc2cccc(C3CCCC=CN3)c2)cc1 |
| InChI | InChI=1S/C18H18FNO/c19-15-8-10-16(11-9-15)21-17-6-4-5-14(13-17)18-7-2-1-3-12-20-18/h3-6,8-13,18,20H,1-2,7H2 |
| InChIKey | YWWSNOAQBNXMOM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |