C20H22F6N6 — CID 162038302
benzene-1,3-diamine;benzene-1,4-diamine;3,4-bis(trifluoromethyl)benzene-1,2-diamine (PubChem CID 162038302) has the molecular formula C20H22F6N6 and a molecular weight of 460.43 g/mol. Its IUPAC name is benzene-1,3-diamine;benzene-1,4-diamine;3,4-bis(trifluoromethyl)benzene-1,2-diamine.
| Compound Name | benzene-1,3-diamine;benzene-1,4-diamine;3,4-bis(trifluoromethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 162038302 |
| Molecular Formula | C20H22F6N6 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | benzene-1,3-diamine;benzene-1,4-diamine;3,4-bis(trifluoromethyl)benzene-1,2-diamine |
| SMILES | Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1N.Nc1ccc(N)cc1.Nc1cccc(N)c1 |
| InChI | InChI=1S/C8H6F6N2.2C6H8N2/c9-7(10,11)3-1-2-4(15)6(16)5(3)8(12,13)14;7-5-1-2-6(8)4-3-5;7-5-2-1-3-6(8)4-5/h1-2H,15-16H2;2*1-4H,7-8H2 |
| InChIKey | YWXZSTALTKSZGK-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 156.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|