C14H16F3N — CID 162038595
5-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-3H-indole (PubChem CID 162038595) has the molecular formula C14H16F3N and a molecular weight of 255.28 g/mol. Its IUPAC name is 5-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-3H-indole.
| Compound Name | 5-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-3H-indole |
|---|---|
| PubChem CID | 162038595 |
| Molecular Formula | C14H16F3N |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 5-methyl-2-(3,3,3-trifluoro-2,2-dimethylpropyl)-3H-indole |
| SMILES | Cc1ccc2c(c1)CC(CC(C)(C)C(F)(F)F)=N2 |
| InChI | InChI=1S/C14H16F3N/c1-9-4-5-12-10(6-9)7-11(18-12)8-13(2,3)14(15,16)17/h4-6H,7-8H2,1-3H3 |
| InChIKey | PZKOBEALMTUFBN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |