About 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole
1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole (PubChem CID 162038803) has the molecular formula C10H18N8
and a molecular weight of 250.31 g/mol. Its IUPAC name is 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole.
Molecular Properties
| Compound Name | 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole |
| PubChem CID | 162038803 |
| Molecular Formula | C10H18N8 |
| Molecular Weight | 250.31 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole |
| SMILES | C1CN2CCC1CC2.c1cn[nH]n1.c1nn[nH]n1 |
| InChI | InChI=1S/C7H13N.C2H3N3.CH2N4/c1-4-8-5-2-7(1)3-6-8;2*1-2-4-5-3-1/h7H,1-6H2;1-2H,(H,3,4,5);1H,(H,2,3,4,5) |
| InChIKey | YWZMUKZPUHZTDA-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 99.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.31 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole?
The IUPAC name of 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole (CID 162038803) is 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole.
What is the SMILES notation for 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole?
The canonical SMILES for 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole is C1CN2CCC1CC2.c1cn[nH]n1.c1nn[nH]n1.
What is the InChIKey of 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole?
The InChIKey is YWZMUKZPUHZTDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N.C2H3N3.CH2N4/c1-4-8-5-2-7(1)3-6-8;2*1-2-4-5-3-1/h7H,1-6H2;1-2H,(H,3,4,5);1H,(H,2,3,4,5).
What are the key properties of 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole?
1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole has a molecular weight of 250.31 g/mol, XLogP of 0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[2.2.2]octane;2H-tetrazole;2H-triazole is sourced from PubChem (CID 162038803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).