About bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one
bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one (PubChem CID 162039075) has the molecular formula C14H24N6O2
and a molecular weight of 308.39 g/mol. Its IUPAC name is bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one |
| PubChem CID | 162039075 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one |
| SMILES | CC(N)N.CC(N)N.O=c1cccc(-c2cccc(=O)[nH]2)[nH]1 |
| InChI | InChI=1S/C10H8N2O2.2C2H8N2/c13-9-5-1-3-7(11-9)8-4-2-6-10(14)12-8;2*1-2(3)4/h1-6H,(H,11,13)(H,12,14);2*2H,3-4H2,1H3 |
| InChIKey | YXAJNUNHDQQDRQ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one?
The IUPAC name of bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one (CID 162039075) is bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one.
What is the SMILES notation for bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one?
The canonical SMILES for bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one is CC(N)N.CC(N)N.O=c1cccc(-c2cccc(=O)[nH]2)[nH]1.
What is the InChIKey of bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one?
The InChIKey is YXAJNUNHDQQDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2.2C2H8N2/c13-9-5-1-3-7(11-9)8-4-2-6-10(14)12-8;2*1-2(3)4/h1-6H,(H,11,13)(H,12,14);2*2H,3-4H2,1H3.
What are the key properties of bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one?
bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one has a molecular weight of 308.39 g/mol, XLogP of -0.77, 1 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethane-1,1-diamine);6-(6-oxo-1H-pyridin-2-yl)-1H-pyridin-2-one is sourced from PubChem (CID 162039075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).