C26H34N2O5 — CID 162041582
tert-butyl 4-[(3S)-4-(4-aminophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]benzoate (PubChem CID 162041582) has the molecular formula C26H34N2O5 and a molecular weight of 454.57 g/mol. Its IUPAC name is tert-butyl 4-[(3S)-4-(4-aminophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]benzoate.
| Compound Name | tert-butyl 4-[(3S)-4-(4-aminophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]benzoate |
|---|---|
| PubChem CID | 162041582 |
| Molecular Formula | C26H34N2O5 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | tert-butyl 4-[(3S)-4-(4-aminophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxobutyl]benzoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(N)cc1)C(=O)Cc1ccc(C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C26H34N2O5/c1-25(2,3)32-23(30)19-11-7-18(8-12-19)16-22(29)21(28-24(31)33-26(4,5)6)15-17-9-13-20(27)14-10-17/h7-14,21H,15-16,27H2,1-6H3,(H,28,31)/t21-/m0/s1 |
| InChIKey | YXIRMJSDPFAKKC-NRFANRHFSA-N |
| XLogP | 4.47 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|