About 1-methylpiperazine;quinoline-3-carbonitrile
1-methylpiperazine;quinoline-3-carbonitrile (PubChem CID 162042146) has the molecular formula C15H18N4
and a molecular weight of 254.34 g/mol. Its IUPAC name is 1-methylpiperazine;quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 1-methylpiperazine;quinoline-3-carbonitrile |
| PubChem CID | 162042146 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-methylpiperazine;quinoline-3-carbonitrile |
| SMILES | CN1CCNCC1.N#Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H6N2.C5H12N2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8;1-7-4-2-6-3-5-7/h1-5,7H;6H,2-5H2,1H3 |
| InChIKey | YXKOVKNEHKFQNP-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylpiperazine;quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperazine;quinoline-3-carbonitrile?
The IUPAC name of 1-methylpiperazine;quinoline-3-carbonitrile (CID 162042146) is 1-methylpiperazine;quinoline-3-carbonitrile.
What is the SMILES notation for 1-methylpiperazine;quinoline-3-carbonitrile?
The canonical SMILES for 1-methylpiperazine;quinoline-3-carbonitrile is CN1CCNCC1.N#Cc1cnc2ccccc2c1.
What is the InChIKey of 1-methylpiperazine;quinoline-3-carbonitrile?
The InChIKey is YXKOVKNEHKFQNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2.C5H12N2/c11-6-8-5-9-3-1-2-4-10(9)12-7-8;1-7-4-2-6-3-5-7/h1-5,7H;6H,2-5H2,1H3.
What are the key properties of 1-methylpiperazine;quinoline-3-carbonitrile?
1-methylpiperazine;quinoline-3-carbonitrile has a molecular weight of 254.34 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperazine;quinoline-3-carbonitrile is sourced from PubChem (CID 162042146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).