C12H8F6O6 — CID 162043953
3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate (PubChem CID 162043953) has the molecular formula C12H8F6O6 and a molecular weight of 362.18 g/mol. Its IUPAC name is 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate.
| Compound Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162043953 |
| Molecular Formula | C12H8F6O6 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 3a,4,5,7a-tetrahydro-2-benzofuran-1,3-dione;(2,2,2-trifluoroacetyl) 2,2,2-trifluoroacetate |
| SMILES | O=C(OC(=O)C(F)(F)F)C(F)(F)F.O=C1OC(=O)C2CCC=CC12 |
| InChI | InChI=1S/C8H8O3.C4F6O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;5-3(6,7)1(11)13-2(12)4(8,9)10/h1,3,5-6H,2,4H2; |
| InChIKey | YXQJUGAILCYAGK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|