C20H19ClF6N4O4 — CID 162044011
ethyl 1-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxylate;[4-(trifluoromethoxy)phenyl]hydrazine;hydrochloride (PubChem CID 162044011) has the molecular formula C20H19ClF6N4O4 and a molecular weight of 528.84 g/mol. Its IUPAC name is ethyl 1-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxylate;[4-(trifluoromethoxy)phenyl]hydrazine;hydrochloride.
| Compound Name | ethyl 1-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxylate;[4-(trifluoromethoxy)phenyl]hydrazine;hydrochloride |
|---|---|
| PubChem CID | 162044011 |
| Molecular Formula | C20H19ClF6N4O4 |
| Molecular Weight | 528.84 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | ethyl 1-[4-(trifluoromethoxy)phenyl]pyrazole-4-carboxylate;[4-(trifluoromethoxy)phenyl]hydrazine;hydrochloride |
| SMILES | CCOC(=O)c1cnn(-c2ccc(OC(F)(F)F)cc2)c1.Cl.NNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F3N2O3.C7H7F3N2O.ClH/c1-2-20-12(19)9-7-17-18(8-9)10-3-5-11(6-4-10)21-13(14,15)16;8-7(9,10)13-6-3-1-5(12-11)2-4-6;/h3-8H,2H2,1H3;1-4,12H,11H2;1H |
| InChIKey | RILRWAXZPILDMN-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.84 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|