C25H51NO11Si2 — CID 162044574
(3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one;4-methylmorpholine;(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one (PubChem CID 162044574) has the molecular formula C25H51NO11Si2 and a molecular weight of 597.85 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one;4-methylmorpholine;(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one;4-methylmorpholine;(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 162044574 |
| Molecular Formula | C25H51NO11Si2 |
| Molecular Weight | 597.85 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | (3R,4S,5R,6R)-6-ethyl-5-methyl-3,4-bis(trimethylsilyloxy)oxan-2-one;4-methylmorpholine;(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1C.CN1CCOCC1.O=C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H30O4Si2.C6H10O6.C5H11NO/c1-9-11-10(2)12(17-19(3,4)5)13(14(15)16-11)18-20(6,7)8;7-1-2-3(8)4(9)5(10)6(11)12-2;1-6-2-4-7-5-3-6/h10-13H,9H2,1-8H3;2-5,7-10H,1H2;2-5H2,1H3/t10-,11-,12+,13-;2-,3-,4+,5-;/m11./s1 |
| InChIKey | YXSJWSIUFQULKT-ZSNXPLKPSA-N |
| XLogP | 0.33 |
| TPSA | 164.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.85 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|