C17H17BrF3NO — CID 162046061
2-bromo-1,4-difluorobenzene;(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine (PubChem CID 162046061) has the molecular formula C17H17BrF3NO and a molecular weight of 388.23 g/mol. Its IUPAC name is 2-bromo-1,4-difluorobenzene;(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine.
| Compound Name | 2-bromo-1,4-difluorobenzene;(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine |
|---|---|
| PubChem CID | 162046061 |
| Molecular Formula | C17H17BrF3NO |
| Molecular Weight | 388.23 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2-bromo-1,4-difluorobenzene;(2R)-2-(5-fluoro-2-methoxyphenyl)pyrrolidine |
| SMILES | COc1ccc(F)cc1[C@H]1CCCN1.Fc1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C11H14FNO.C6H3BrF2/c1-14-11-5-4-8(12)7-9(11)10-3-2-6-13-10;7-5-3-4(8)1-2-6(5)9/h4-5,7,10,13H,2-3,6H2,1H3;1-3H/t10-;/m1./s1 |
| InChIKey | YXXARMGJDQPEIB-HNCPQSOCSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.23 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|