C8H9F2NO2 — CID 162046819
6-(2,2-difluoroethoxy)-5-methyl-1H-pyridin-2-one (PubChem CID 162046819) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 6-(2,2-difluoroethoxy)-5-methyl-1H-pyridin-2-one.
| Compound Name | 6-(2,2-difluoroethoxy)-5-methyl-1H-pyridin-2-one |
|---|---|
| PubChem CID | 162046819 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 6-(2,2-difluoroethoxy)-5-methyl-1H-pyridin-2-one |
| SMILES | Cc1ccc(=O)[nH]c1OCC(F)F |
| InChI | InChI=1S/C8H9F2NO2/c1-5-2-3-7(12)11-8(5)13-4-6(9)10/h2-3,6H,4H2,1H3,(H,11,12) |
| InChIKey | YXZPLTODVMJCSH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |