C21H26F3N5O2Si — CID 162048209
N-[(1R)-1-[4-(trifluoromethyl)-2-pyridinyl]ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 162048209) has the molecular formula C21H26F3N5O2Si and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[(1R)-1-[4-(trifluoromethyl)-2-pyridinyl]ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(1R)-1-[4-(trifluoromethyl)-2-pyridinyl]ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 162048209 |
| Molecular Formula | C21H26F3N5O2Si |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[(1R)-1-[4-(trifluoromethyl)-2-pyridinyl]ethyl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C[C@@H](NC(=O)c1cn(COCC[Si](C)(C)C)c2nccnc12)c1cc(C(F)(F)F)ccn1 |
| InChI | InChI=1S/C21H26F3N5O2Si/c1-14(17-11-15(5-6-25-17)21(22,23)24)28-20(30)16-12-29(13-31-9-10-32(2,3)4)19-18(16)26-7-8-27-19/h5-8,11-12,14H,9-10,13H2,1-4H3,(H,28,30)/t14-/m1/s1 |
| InChIKey | YYEPBJZMQSAIQR-CQSZACIVSA-N |
| XLogP | 4.65 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|