C23H34O4Si — CID 162048676
(1R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxopentyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-carbaldehyde (PubChem CID 162048676) has the molecular formula C23H34O4Si and a molecular weight of 402.61 g/mol. Its IUPAC name is (1R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxopentyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-carbaldehyde.
| Compound Name | (1R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxopentyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-carbaldehyde |
|---|---|
| PubChem CID | 162048676 |
| Molecular Formula | C23H34O4Si |
| Molecular Weight | 402.61 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (1R,3aS,8bS)-2-[tert-butyl(dimethyl)silyl]oxy-5-(4-oxopentyl)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-1-carbaldehyde |
| SMILES | CC(=O)CCCc1cccc2c1O[C@H]1CC(O[Si](C)(C)C(C)(C)C)[C@H](C=O)[C@@H]21 |
| InChI | InChI=1S/C23H34O4Si/c1-15(25)9-7-10-16-11-8-12-17-21-18(14-24)19(13-20(21)26-22(16)17)27-28(5,6)23(2,3)4/h8,11-12,14,18-21H,7,9-10,13H2,1-6H3/t18-,19?,20-,21+/m0/s1 |
| InChIKey | GVAPTKZCCHWANY-UDEWTMQYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.61 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|