C43H36N6O2 — CID 162048919
4-[5-(4-but-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile;4-[5-(4-pent-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile (PubChem CID 162048919) has the molecular formula C43H36N6O2 and a molecular weight of 668.80 g/mol. Its IUPAC name is 4-[5-(4-but-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile;4-[5-(4-pent-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile.
| Compound Name | 4-[5-(4-but-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile;4-[5-(4-pent-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 162048919 |
| Molecular Formula | C43H36N6O2 |
| Molecular Weight | 668.80 g/mol |
| Exact Mass | 668.29 |
| IUPAC Name | 4-[5-(4-but-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile;4-[5-(4-pent-2-enoxyphenyl)pyrimidin-2-yl]benzonitrile |
| SMILES | CC=CCOc1ccc(-c2cnc(-c3ccc(C#N)cc3)nc2)cc1.CCC=CCOc1ccc(-c2cnc(-c3ccc(C#N)cc3)nc2)cc1 |
| InChI | InChI=1S/C22H19N3O.C21H17N3O/c1-2-3-4-13-26-21-11-9-18(10-12-21)20-15-24-22(25-16-20)19-7-5-17(14-23)6-8-19;1-2-3-12-25-20-10-8-17(9-11-20)19-14-23-21(24-15-19)18-6-4-16(13-22)5-7-18/h3-12,15-16H,2,13H2,1H3;2-11,14-15H,12H2,1H3 |
| InChIKey | YYHCTGLGDSGIEJ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 117.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.80 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|