About 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol)
21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) (PubChem CID 162049148) has the molecular formula C40H32N6O2
and a molecular weight of 628.74 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol).
Molecular Properties
| Compound Name | 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) |
| PubChem CID | 162049148 |
| Molecular Formula | C40H32N6O2 |
| Molecular Weight | 628.74 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1 |
| InChI | InChI=1S/C20H14N4.2C10H9NO/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7/h1-12,21-22H;2*2-6,12H,1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | WMKPHJTXSOGYJU-IAULSPAKSA-N |
| XLogP | 9.15 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 628.74 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol)?
The IUPAC name of 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) (CID 162049148) is 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol).
What is the SMILES notation for 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol)?
The canonical SMILES for 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.Cc1ccc2cccc(O)c2n1.Cc1ccc2cccc(O)c2n1.
What is the InChIKey of 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol)?
The InChIKey is WMKPHJTXSOGYJU-IAULSPAKSA-N. The full InChI is InChI=1S/C20H14N4.2C10H9NO/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7/h1-12,21-22H;2*2-6,12H,1H3/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol)?
21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) has a molecular weight of 628.74 g/mol, XLogP of 9.15, 0 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 21,22-dihydroporphyrin;bis(2-methylquinolin-8-ol) is sourced from PubChem (CID 162049148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).