C57H66F9N3O3 — CID 162050926
2-heptyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-hexyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-octyl-5-[4-(trifluoromethoxy)phenyl]pyridine (PubChem CID 162050926) has the molecular formula C57H66F9N3O3 and a molecular weight of 1012.16 g/mol. Its IUPAC name is 2-heptyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-hexyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-octyl-5-[4-(trifluoromethoxy)phenyl]pyridine.
| Compound Name | 2-heptyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-hexyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-octyl-5-[4-(trifluoromethoxy)phenyl]pyridine |
|---|---|
| PubChem CID | 162050926 |
| Molecular Formula | C57H66F9N3O3 |
| Molecular Weight | 1012.16 g/mol |
| Exact Mass | 1011.50 |
| IUPAC Name | 2-heptyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-hexyl-5-[4-(trifluoromethoxy)phenyl]pyridine;2-octyl-5-[4-(trifluoromethoxy)phenyl]pyridine |
| SMILES | CCCCCCCCc1ccc(-c2ccc(OC(F)(F)F)cc2)cn1.CCCCCCCc1ccc(-c2ccc(OC(F)(F)F)cc2)cn1.CCCCCCc1ccc(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C20H24F3NO.C19H22F3NO.C18H20F3NO/c1-2-3-4-5-6-7-8-18-12-9-17(15-24-18)16-10-13-19(14-11-16)25-20(21,22)23;1-2-3-4-5-6-7-17-11-8-16(14-23-17)15-9-12-18(13-10-15)24-19(20,21)22;1-2-3-4-5-6-16-10-7-15(13-22-16)14-8-11-17(12-9-14)23-18(19,20)21/h9-15H,2-8H2,1H3;8-14H,2-7H2,1H3;7-13H,2-6H2,1H3 |
| InChIKey | YYNNWNPXNOWMPH-UHFFFAOYSA-N |
| XLogP | 18.48 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1012.16 |
| LogP ≤ 5 | 18.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|