C26H20F12 — CID 162052100
1,4-diethyl-2,3,5,6-tetrafluorobenzene;1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene (PubChem CID 162052100) has the molecular formula C26H20F12 and a molecular weight of 560.42 g/mol. Its IUPAC name is 1,4-diethyl-2,3,5,6-tetrafluorobenzene;1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1,4-diethyl-2,3,5,6-tetrafluorobenzene;1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 162052100 |
| Molecular Formula | C26H20F12 |
| Molecular Weight | 560.42 g/mol |
| Exact Mass | 560.14 |
| IUPAC Name | 1,4-diethyl-2,3,5,6-tetrafluorobenzene;1-ethyl-4-(4-ethyl-2,3,5,6-tetrafluorophenyl)-2,3,5,6-tetrafluorobenzene |
| SMILES | CCc1c(F)c(F)c(-c2c(F)c(F)c(CC)c(F)c2F)c(F)c1F.CCc1c(F)c(F)c(CC)c(F)c1F |
| InChI | InChI=1S/C16H10F8.C10H10F4/c1-3-5-9(17)13(21)7(14(22)10(5)18)8-15(23)11(19)6(4-2)12(20)16(8)24;1-3-5-7(11)9(13)6(4-2)10(14)8(5)12/h3-4H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | YYRHJSVGAUCDMI-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.42 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|