C13H22Cl6OSi2 — CID 162052117
4-[2,4-bis(2-trichlorosilylethyl)cyclopentyl]butan-2-one (PubChem CID 162052117) has the molecular formula C13H22Cl6OSi2 and a molecular weight of 463.21 g/mol. Its IUPAC name is 4-[2,4-bis(2-trichlorosilylethyl)cyclopentyl]butan-2-one.
| Compound Name | 4-[2,4-bis(2-trichlorosilylethyl)cyclopentyl]butan-2-one |
|---|---|
| PubChem CID | 162052117 |
| Molecular Formula | C13H22Cl6OSi2 |
| Molecular Weight | 463.21 g/mol |
| Exact Mass | 459.93 |
| IUPAC Name | 4-[2,4-bis(2-trichlorosilylethyl)cyclopentyl]butan-2-one |
| SMILES | CC(=O)CCC1CC(CC[Si](Cl)(Cl)Cl)CC1CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C13H22Cl6OSi2/c1-10(20)2-3-12-8-11(4-6-21(14,15)16)9-13(12)5-7-22(17,18)19/h11-13H,2-9H2,1H3 |
| InChIKey | HQAVWZSYSPHXMI-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.21 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|