About hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate
hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate (PubChem CID 162054409) has the molecular formula C15H31N3O6
and a molecular weight of 349.43 g/mol. Its IUPAC name is hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate.
Molecular Properties
| Compound Name | hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate |
| PubChem CID | 162054409 |
| Molecular Formula | C15H31N3O6 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate |
| SMILES | CCOCCN(CCOCC)CCC(=O)OC1CCOC1=O.NN |
| InChI | InChI=1S/C15H27NO6.H4N2/c1-3-19-11-8-16(9-12-20-4-2)7-5-14(17)22-13-6-10-21-15(13)18;1-2/h13H,3-12H2,1-2H3;1-2H2 |
| InChIKey | YYZGGOXGGVGXGL-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate?
The IUPAC name of hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate (CID 162054409) is hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate.
What is the SMILES notation for hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate?
The canonical SMILES for hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate is CCOCCN(CCOCC)CCC(=O)OC1CCOC1=O.NN.
What is the InChIKey of hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate?
The InChIKey is YYZGGOXGGVGXGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO6.H4N2/c1-3-19-11-8-16(9-12-20-4-2)7-5-14(17)22-13-6-10-21-15(13)18;1-2/h13H,3-12H2,1-2H3;1-2H2.
What are the key properties of hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate?
hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate has a molecular weight of 349.43 g/mol, XLogP of -0.57, 12 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;(2-oxooxolan-3-yl) 3-[bis(2-ethoxyethyl)amino]propanoate is sourced from PubChem (CID 162054409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).