C31H34N2O5 — CID 162056976
2-(4-ethyl-2-methoxyphenoxy)aniline;N-[2-(4-ethyl-2-methoxyphenoxy)phenyl]formamide (PubChem CID 162056976) has the molecular formula C31H34N2O5 and a molecular weight of 514.62 g/mol. Its IUPAC name is 2-(4-ethyl-2-methoxyphenoxy)aniline;N-[2-(4-ethyl-2-methoxyphenoxy)phenyl]formamide.
| Compound Name | 2-(4-ethyl-2-methoxyphenoxy)aniline;N-[2-(4-ethyl-2-methoxyphenoxy)phenyl]formamide |
|---|---|
| PubChem CID | 162056976 |
| Molecular Formula | C31H34N2O5 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 2-(4-ethyl-2-methoxyphenoxy)aniline;N-[2-(4-ethyl-2-methoxyphenoxy)phenyl]formamide |
| SMILES | CCc1ccc(Oc2ccccc2N)c(OC)c1.CCc1ccc(Oc2ccccc2NC=O)c(OC)c1 |
| InChI | InChI=1S/C16H17NO3.C15H17NO2/c1-3-12-8-9-15(16(10-12)19-2)20-14-7-5-4-6-13(14)17-11-18;1-3-11-8-9-14(15(10-11)17-2)18-13-7-5-4-6-12(13)16/h4-11H,3H2,1-2H3,(H,17,18);4-10H,3,16H2,1-2H3 |
| InChIKey | YZHVFRGGWJZYGI-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|