C13H24F4OSi — CID 162057171
tert-butyl-dimethyl-[(2S,3R,5S,6R)-2,3,5,6-tetrafluoro-4-methylcyclohexyl]oxysilane (PubChem CID 162057171) has the molecular formula C13H24F4OSi and a molecular weight of 300.41 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S,3R,5S,6R)-2,3,5,6-tetrafluoro-4-methylcyclohexyl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S,3R,5S,6R)-2,3,5,6-tetrafluoro-4-methylcyclohexyl]oxysilane |
|---|---|
| PubChem CID | 162057171 |
| Molecular Formula | C13H24F4OSi |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | tert-butyl-dimethyl-[(2S,3R,5S,6R)-2,3,5,6-tetrafluoro-4-methylcyclohexyl]oxysilane |
| SMILES | CC1[C@@H](F)[C@@H](F)C(O[Si](C)(C)C(C)(C)C)[C@@H](F)[C@H]1F |
| InChI | InChI=1S/C13H24F4OSi/c1-7-8(14)10(16)12(11(17)9(7)15)18-19(5,6)13(2,3)4/h7-12H,1-6H3/t7?,8-,9+,10-,11+,12? |
| InChIKey | YZIKCEVGKOQBQN-BMACOTTCSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|