C14H22O2 — CID 16205809
methyl 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate (PubChem CID 16205809) has the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. Its IUPAC name is methyl 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate.
| Compound Name | methyl 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 16205809 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | methyl 8,8-dimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalene-2-carboxylate |
| SMILES | CC1(CCCC2=C1CC(CC2)C(=O)OC)C |
| InChI | InChI=1S/C14H22O2/c1-14(2)8-4-5-10-6-7-11(9-12(10)14)13(15)16-3/h11H,4-9H2,1-3H3 |
| InChIKey | QUDFFZGEPJMFBR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 326 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|