C23H39NaO5 — CID 162058598
sodium;2,2,3,3,4,5-hexamethylhex-5-enoic acid;2,2,3,3,5-pentamethyl-4-oxohex-5-enoic acid (PubChem CID 162058598) has the molecular formula C23H39NaO5 and a molecular weight of 418.55 g/mol. Its IUPAC name is sodium;2,2,3,3,4,5-hexamethylhex-5-enoic acid;2,2,3,3,5-pentamethyl-4-oxohex-5-enoic acid.
| Compound Name | sodium;2,2,3,3,4,5-hexamethylhex-5-enoic acid;2,2,3,3,5-pentamethyl-4-oxohex-5-enoic acid |
|---|---|
| PubChem CID | 162058598 |
| Molecular Formula | C23H39NaO5 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | sodium;2,2,3,3,4,5-hexamethylhex-5-enoic acid;2,2,3,3,5-pentamethyl-4-oxohex-5-enoic acid |
| SMILES | C=C(C)C(=O)C(C)(C)C(C)(C)C(=O)O.C=C(C)[C-](C)C(C)(C)C(C)(C)C(=O)O.[Na+] |
| InChI | InChI=1S/C12H21O2.C11H18O3.Na/c1-8(2)9(3)11(4,5)12(6,7)10(13)14;1-7(2)8(12)10(3,4)11(5,6)9(13)14;/h1H2,2-7H3,(H,13,14);1H2,2-6H3,(H,13,14);/q-1;;+1 |
| InChIKey | INMDKYSVXGWZCU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|