C20H36N5OS+3 — CID 162058677
2,3,4,5-tetramethyl-1,3-oxazol-3-ium;2,3,4,5-tetramethyl-1,3-thiazol-3-ium;1,3,4,5-tetramethyl-1,2,4-triazol-4-ium (PubChem CID 162058677) has the molecular formula C20H36N5OS+3 and a molecular weight of 394.61 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-1,3-oxazol-3-ium;2,3,4,5-tetramethyl-1,3-thiazol-3-ium;1,3,4,5-tetramethyl-1,2,4-triazol-4-ium.
| Compound Name | 2,3,4,5-tetramethyl-1,3-oxazol-3-ium;2,3,4,5-tetramethyl-1,3-thiazol-3-ium;1,3,4,5-tetramethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 162058677 |
| Molecular Formula | C20H36N5OS+3 |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 2,3,4,5-tetramethyl-1,3-oxazol-3-ium;2,3,4,5-tetramethyl-1,3-thiazol-3-ium;1,3,4,5-tetramethyl-1,2,4-triazol-4-ium |
| SMILES | Cc1nn(C)c(C)[n+]1C.Cc1oc(C)[n+](C)c1C.Cc1sc(C)[n+](C)c1C |
| InChI | InChI=1S/C7H12NO.C7H12NS.C6H12N3/c2*1-5-6(2)9-7(3)8(5)4;1-5-7-9(4)6(2)8(5)3/h3*1-4H3/q3*+1 |
| InChIKey | XKMQMPVJYOIGPP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 42.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|