C17H10F8O4 — CID 162059106
methyl 2,3,5,6-tetrafluoro-4-methylbenzoate;2,3,5,6-tetrafluoro-4-methylbenzoic acid (PubChem CID 162059106) has the molecular formula C17H10F8O4 and a molecular weight of 430.25 g/mol. Its IUPAC name is methyl 2,3,5,6-tetrafluoro-4-methylbenzoate;2,3,5,6-tetrafluoro-4-methylbenzoic acid.
| Compound Name | methyl 2,3,5,6-tetrafluoro-4-methylbenzoate;2,3,5,6-tetrafluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 162059106 |
| Molecular Formula | C17H10F8O4 |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | methyl 2,3,5,6-tetrafluoro-4-methylbenzoate;2,3,5,6-tetrafluoro-4-methylbenzoic acid |
| SMILES | COC(=O)c1c(F)c(F)c(C)c(F)c1F.Cc1c(F)c(F)c(C(=O)O)c(F)c1F |
| InChI | InChI=1S/C9H6F4O2.C8H4F4O2/c1-3-5(10)7(12)4(9(14)15-2)8(13)6(3)11;1-2-4(9)6(11)3(8(13)14)7(12)5(2)10/h1-2H3;1H3,(H,13,14) |
| InChIKey | YZOVMOBPLGWYML-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|