C15H20N2O6S — CID 162066245
N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5-(4-methylphenyl)sulfonylpentane-2,3-dione (PubChem CID 162066245) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5-(4-methylphenyl)sulfonylpentane-2,3-dione.
| Compound Name | N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5-(4-methylphenyl)sulfonylpentane-2,3-dione |
|---|---|
| PubChem CID | 162066245 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5-(4-methylphenyl)sulfonylpentane-2,3-dione |
| SMILES | CC(=O)C(=O)C(C)CS(=O)(=O)c1ccc(C)cc1.ON=CC=NO |
| InChI | InChI=1S/C13H16O4S.C2H4N2O2/c1-9-4-6-12(7-5-9)18(16,17)8-10(2)13(15)11(3)14;5-3-1-2-4-6/h4-7,10H,8H2,1-3H3;1-2,5-6H |
| InChIKey | ZAMMHPRDPVNWSH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 133.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|