About CID 162066270
CID 162066270 (PubChem CID 162066270) has the molecular formula H5N3O5SSi
and a molecular weight of 187.21 g/mol.
Molecular Properties
| Compound Name | CID 162066270 |
| PubChem CID | 162066270 |
| Molecular Formula | H5N3O5SSi |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | — |
| SMILES | [H]/N=N/N(OOS)OOO[SiH3] |
| InChI | InChI=1S/H5N3O5SSi/c1-2-3(5-7-9)4-6-8-10/h1,9H,10H3/b2-1+ |
| InChIKey | RRWIVQWVZROMAJ-OWOJBTEDSA-N |
| XLogP | -0.98 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 162066270 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162066270?
The IUPAC name of CID 162066270 (CID 162066270) is not available.
What is the SMILES notation for CID 162066270?
The canonical SMILES for CID 162066270 is [H]/N=N/N(OOS)OOO[SiH3].
What is the InChIKey of CID 162066270?
The InChIKey is RRWIVQWVZROMAJ-OWOJBTEDSA-N. The full InChI is InChI=1S/H5N3O5SSi/c1-2-3(5-7-9)4-6-8-10/h1,9H,10H3/b2-1+.
What are the key properties of CID 162066270?
CID 162066270 has a molecular weight of 187.21 g/mol, XLogP of -0.98, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162066270 is sourced from PubChem (CID 162066270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).