C26H28ClN7OS — CID 162067148
N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-3-ethylbenzamide (PubChem CID 162067148) has the molecular formula C26H28ClN7OS and a molecular weight of 522.08 g/mol. Its IUPAC name is N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-3-ethylbenzamide.
| Compound Name | N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-3-ethylbenzamide |
|---|---|
| PubChem CID | 162067148 |
| Molecular Formula | C26H28ClN7OS |
| Molecular Weight | 522.08 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[4-[4-(azetidin-1-yl)-6-[[(Z)-1,3-diaminobut-2-enylidene]amino]pyrimidin-2-yl]sulfanylphenyl]-2-chloro-3-ethylbenzamide |
| SMILES | CCc1cccc(C(=O)Nc2ccc(Sc3nc(N=C(N)/C=C(/C)N)cc(N4CCC4)n3)cc2)c1Cl |
| InChI | InChI=1S/C26H28ClN7OS/c1-3-17-6-4-7-20(24(17)27)25(35)30-18-8-10-19(11-9-18)36-26-32-22(31-21(29)14-16(2)28)15-23(33-26)34-12-5-13-34/h4,6-11,14-15H,3,5,12-13,28H2,1-2H3,(H,30,35)(H2,29,31,32,33)/b16-14- |
| InChIKey | SDLUHQMIQRORDM-PEZBUJJGSA-N |
| XLogP | 5.16 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|