C10H8F6O4 — CID 162068165
[1-(2,2,2-trifluoroacetyl)oxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate (PubChem CID 162068165) has the molecular formula C10H8F6O4 and a molecular weight of 306.16 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroacetyl)oxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [1-(2,2,2-trifluoroacetyl)oxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162068165 |
| Molecular Formula | C10H8F6O4 |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | [1-(2,2,2-trifluoroacetyl)oxycyclohex-2-en-1-yl] 2,2,2-trifluoroacetate |
| SMILES | O=C(OC1(OC(=O)C(F)(F)F)C=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H8F6O4/c11-9(12,13)6(17)19-8(4-2-1-3-5-8)20-7(18)10(14,15)16/h2,4H,1,3,5H2 |
| InChIKey | ZASMIUCBTDQHMN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|