C29H46F2O3Si2 — CID 162069772
3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorobenzaldehyde;tert-butyl-[2-(2-fluorophenyl)ethoxy]-dimethylsilane (PubChem CID 162069772) has the molecular formula C29H46F2O3Si2 and a molecular weight of 536.85 g/mol. Its IUPAC name is 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorobenzaldehyde;tert-butyl-[2-(2-fluorophenyl)ethoxy]-dimethylsilane.
| Compound Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorobenzaldehyde;tert-butyl-[2-(2-fluorophenyl)ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 162069772 |
| Molecular Formula | C29H46F2O3Si2 |
| Molecular Weight | 536.85 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | 3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2-fluorobenzaldehyde;tert-butyl-[2-(2-fluorophenyl)ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCc1cccc(C=O)c1F.CC(C)(C)[Si](C)(C)OCCc1ccccc1F |
| InChI | InChI=1S/C15H23FO2Si.C14H23FOSi/c1-15(2,3)19(4,5)18-10-9-12-7-6-8-13(11-17)14(12)16;1-14(2,3)17(4,5)16-11-10-12-8-6-7-9-13(12)15/h6-8,11H,9-10H2,1-5H3;6-9H,10-11H2,1-5H3 |
| InChIKey | ZAXPAPQQOLCTIM-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.85 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|