About 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one
4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one (PubChem CID 162070057) has the molecular formula C22H11Cl2NO2
and a molecular weight of 392.24 g/mol. Its IUPAC name is 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one.
Molecular Properties
| Compound Name | 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one |
| PubChem CID | 162070057 |
| Molecular Formula | C22H11Cl2NO2 |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one |
| SMILES | O=C1OC(c2ccccc2)=NC1=C1c2ccccc2-c2c(Cl)cc(Cl)cc21 |
| InChI | InChI=1S/C22H11Cl2NO2/c23-13-10-16-18(17(24)11-13)14-8-4-5-9-15(14)19(16)20-22(26)27-21(25-20)12-6-2-1-3-7-12/h1-11H |
| InChIKey | SETUVMOJOLLYMX-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one?
The IUPAC name of 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one (CID 162070057) is 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one.
What is the SMILES notation for 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one?
The canonical SMILES for 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one is O=C1OC(c2ccccc2)=NC1=C1c2ccccc2-c2c(Cl)cc(Cl)cc21.
What is the InChIKey of 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one?
The InChIKey is SETUVMOJOLLYMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H11Cl2NO2/c23-13-10-16-18(17(24)11-13)14-8-4-5-9-15(14)19(16)20-22(26)27-21(25-20)12-6-2-1-3-7-12/h1-11H.
What are the key properties of 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one?
4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one has a molecular weight of 392.24 g/mol, XLogP of 5.74, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorofluoren-9-ylidene)-2-phenyl-1,3-oxazol-5-one is sourced from PubChem (CID 162070057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).