C20H15BrCl2N2O3 — CID 162070769
6-(3-bromopropyl)-8-chloro-4-(2-chlorophenyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carbaldehyde;molecular hydrogen (PubChem CID 162070769) has the molecular formula C20H15BrCl2N2O3 and a molecular weight of 482.16 g/mol. Its IUPAC name is 6-(3-bromopropyl)-8-chloro-4-(2-chlorophenyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carbaldehyde;molecular hydrogen.
| Compound Name | 6-(3-bromopropyl)-8-chloro-4-(2-chlorophenyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carbaldehyde;molecular hydrogen |
|---|---|
| PubChem CID | 162070769 |
| Molecular Formula | C20H15BrCl2N2O3 |
| Molecular Weight | 482.16 g/mol |
| Exact Mass | 479.96 |
| IUPAC Name | 6-(3-bromopropyl)-8-chloro-4-(2-chlorophenyl)-1,3-dioxopyrrolo[3,4-e]indole-7-carbaldehyde;molecular hydrogen |
| SMILES | O=Cc1c(Cl)c2c3c(c(-c4ccccc4Cl)cc2n1CCCBr)C(=O)NC3=O.[H][H] |
| InChI | InChI=1S/C20H13BrCl2N2O3.H2/c21-6-3-7-25-13-8-11(10-4-1-2-5-12(10)22)15-17(20(28)24-19(15)27)16(13)18(23)14(25)9-26;/h1-2,4-5,8-9H,3,6-7H2,(H,24,27,28);1H |
| InChIKey | ZBAXDHUNOHHXNQ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.16 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|