About (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane
(3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane (PubChem CID 162071384) has the molecular formula C10H13FO2S
and a molecular weight of 216.28 g/mol. Its IUPAC name is (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane.
Molecular Properties
| Compound Name | (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane |
| PubChem CID | 162071384 |
| Molecular Formula | C10H13FO2S |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane |
| SMILES | COC[C@H]1COc2c(F)cccc21.S |
| InChI | InChI=1S/C10H11FO2.H2S/c1-12-5-7-6-13-10-8(7)3-2-4-9(10)11;/h2-4,7H,5-6H2,1H3;1H2/t7-;/m0./s1 |
| InChIKey | ZBDADBWXNRZZSQ-FJXQXJEOSA-N |
| XLogP | 2.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane?
The IUPAC name of (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane (CID 162071384) is (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane.
What is the SMILES notation for (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane?
The canonical SMILES for (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane is COC[C@H]1COc2c(F)cccc21.S.
What is the InChIKey of (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane?
The InChIKey is ZBDADBWXNRZZSQ-FJXQXJEOSA-N. The full InChI is InChI=1S/C10H11FO2.H2S/c1-12-5-7-6-13-10-8(7)3-2-4-9(10)11;/h2-4,7H,5-6H2,1H3;1H2/t7-;/m0./s1.
What are the key properties of (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane?
(3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane has a molecular weight of 216.28 g/mol, XLogP of 2.06, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-7-fluoro-3-(methoxymethyl)-2,3-dihydro-1-benzofuran;sulfane is sourced from PubChem (CID 162071384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).