C30H36BN2O7 — CID 162071995
CID 162071995 (PubChem CID 162071995) has the molecular formula C30H36BN2O7 and a molecular weight of 547.44 g/mol.
| Compound Name | CID 162071995 |
|---|---|
| PubChem CID | 162071995 |
| Molecular Formula | C30H36BN2O7 |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | — |
| SMILES | CCOc1cc(C(=O)N2C3CCC2COC3)ccc1C(=O)CC[C@@H](O)[C@@H]1Cc2ccc(OC)cc2CN1[B]C=O |
| InChI | InChI=1S/C30H36BN2O7/c1-3-40-29-14-20(30(37)33-22-6-7-23(33)17-39-16-22)5-9-25(29)27(35)10-11-28(36)26-13-19-4-8-24(38-2)12-21(19)15-32(26)31-18-34/h4-5,8-9,12,14,18,22-23,26,28,36H,3,6-7,10-11,13,15-17H2,1-2H3/t22?,23?,26-,28+/m0/s1 |
| InChIKey | LCFMGIYPVLUDNW-CGRSKVOLSA-N |
| XLogP | 2.66 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|