C8H15NO4S — CID 162072286
carbanylium;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate (PubChem CID 162072286) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is carbanylium;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate.
| Compound Name | carbanylium;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 162072286 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | carbanylium;2-methyl-2-(prop-2-enoylamino)propane-1-sulfonate |
| SMILES | C=CC(=O)NC(C)(C)CS(=O)(=O)[O-].[CH3+] |
| InChI | InChI=1S/C7H13NO4S.CH3/c1-4-6(9)8-7(2,3)5-13(10,11)12;/h4H,1,5H2,2-3H3,(H,8,9)(H,10,11,12);1H3/q;+1/p-1 |
| InChIKey | ZBGCENVTLGFSBX-UHFFFAOYSA-M |
| XLogP | 0.06 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|