C14H44O7Si7 — CID 162072780
bis(trimethylsilyloxy)silyloxy-trimethylsilane;2,4,6,8-tetramethyl-1,3,5,7,2,4,6-tetraoxatrisilocane (PubChem CID 162072780) has the molecular formula C14H44O7Si7 and a molecular weight of 521.10 g/mol. Its IUPAC name is bis(trimethylsilyloxy)silyloxy-trimethylsilane;2,4,6,8-tetramethyl-1,3,5,7,2,4,6-tetraoxatrisilocane.
| Compound Name | bis(trimethylsilyloxy)silyloxy-trimethylsilane;2,4,6,8-tetramethyl-1,3,5,7,2,4,6-tetraoxatrisilocane |
|---|---|
| PubChem CID | 162072780 |
| Molecular Formula | C14H44O7Si7 |
| Molecular Weight | 521.10 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | bis(trimethylsilyloxy)silyloxy-trimethylsilane;2,4,6,8-tetramethyl-1,3,5,7,2,4,6-tetraoxatrisilocane |
| SMILES | CC1O[SiH](C)O[SiH](C)O[SiH](C)O1.C[Si](C)(C)O[SiH](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H28O3Si4.C5H16O4Si3/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9;1-5-6-10(2)8-12(4)9-11(3)7-5/h13H,1-9H3;5,10-12H,1-4H3 |
| InChIKey | ZBHUHCWGIWSCTC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.10 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|