C15H18F14OS — CID 162072986
1-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfanylpropan-2-ol (PubChem CID 162072986) has the molecular formula C15H18F14OS and a molecular weight of 512.35 g/mol. Its IUPAC name is 1-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfanylpropan-2-ol.
| Compound Name | 1-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 162072986 |
| Molecular Formula | C15H18F14OS |
| Molecular Weight | 512.35 g/mol |
| Exact Mass | 512.09 |
| IUPAC Name | 1-[6,7,7,7-tetrafluoro-4-[2,3,3,3-tetrafluoro-2-(trifluoromethyl)propyl]-6-(trifluoromethyl)heptyl]sulfanylpropan-2-ol |
| SMILES | CC(O)CSCCCC(CC(F)(C(F)(F)F)C(F)(F)F)CC(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H18F14OS/c1-8(30)7-31-4-2-3-9(5-10(16,12(18,19)20)13(21,22)23)6-11(17,14(24,25)26)15(27,28)29/h8-9,30H,2-7H2,1H3 |
| InChIKey | VVOOITAAXKVDAH-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.35 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|