About 2-(methoxymethyl)oxetane;3-methylpent-1-ene
2-(methoxymethyl)oxetane;3-methylpent-1-ene (PubChem CID 162074193) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-(methoxymethyl)oxetane;3-methylpent-1-ene.
Molecular Properties
| Compound Name | 2-(methoxymethyl)oxetane;3-methylpent-1-ene |
| PubChem CID | 162074193 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-(methoxymethyl)oxetane;3-methylpent-1-ene |
| SMILES | C=CC(C)CC.COCC1CCO1 |
| InChI | InChI=1S/C6H12.C5H10O2/c1-4-6(3)5-2;1-6-4-5-2-3-7-5/h4,6H,1,5H2,2-3H3;5H,2-4H2,1H3 |
| InChIKey | ZBMJOPWAXCLGLG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethyl)oxetane;3-methylpent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)oxetane;3-methylpent-1-ene?
The IUPAC name of 2-(methoxymethyl)oxetane;3-methylpent-1-ene (CID 162074193) is 2-(methoxymethyl)oxetane;3-methylpent-1-ene.
What is the SMILES notation for 2-(methoxymethyl)oxetane;3-methylpent-1-ene?
The canonical SMILES for 2-(methoxymethyl)oxetane;3-methylpent-1-ene is C=CC(C)CC.COCC1CCO1.
What is the InChIKey of 2-(methoxymethyl)oxetane;3-methylpent-1-ene?
The InChIKey is ZBMJOPWAXCLGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12.C5H10O2/c1-4-6(3)5-2;1-6-4-5-2-3-7-5/h4,6H,1,5H2,2-3H3;5H,2-4H2,1H3.
What are the key properties of 2-(methoxymethyl)oxetane;3-methylpent-1-ene?
2-(methoxymethyl)oxetane;3-methylpent-1-ene has a molecular weight of 186.29 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)oxetane;3-methylpent-1-ene is sourced from PubChem (CID 162074193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).